C10H9FN2O2 — CID 90825451
3-(3-fluorophenyl)-5H-1,2-oxazole-2-carboxamide (PubChem CID 90825451) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5H-1,2-oxazole-2-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-5H-1,2-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 90825451 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-(3-fluorophenyl)-5H-1,2-oxazole-2-carboxamide |
| SMILES | NC(=O)N1OCC=C1c1cccc(F)c1 |
| InChI | InChI=1S/C10H9FN2O2/c11-8-3-1-2-7(6-8)9-4-5-15-13(9)10(12)14/h1-4,6H,5H2,(H2,12,14) |
| InChIKey | JCGRXQYCKINSKB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |