C10H10N2O2 — CID 15556256
3-phenyl-5H-1,2-oxazole-2-carboxamide (PubChem CID 15556256) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-phenyl-5H-1,2-oxazole-2-carboxamide.
| Compound Name | 3-phenyl-5H-1,2-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 15556256 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-phenyl-5H-1,2-oxazole-2-carboxamide |
| SMILES | NC(=O)N1OCC=C1c1ccccc1 |
| InChI | InChI=1S/C10H10N2O2/c11-10(13)12-9(6-7-14-12)8-4-2-1-3-5-8/h1-6H,7H2,(H2,11,13) |
| InChIKey | PFYHPDLRJAWAPJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |