C9H9NO — CID 14642163
3-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 14642163) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is 3-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 14642163 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 3-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | C1=C(c2ccccc2)NOC1 |
| InChI | InChI=1S/C9H9NO/c1-2-4-8(5-3-1)9-6-7-11-10-9/h1-6,10H,7H2 |
| InChIKey | MGVJSQZSIDKWCQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |