C21H42O — CID 123420659
6,10,14-trimethyl-1-prop-1-en-2-yloxypentadecane (PubChem CID 123420659) has the molecular formula C21H42O and a molecular weight of 310.57 g/mol. Its IUPAC name is 6,10,14-trimethyl-1-prop-1-en-2-yloxypentadecane.
| Compound Name | 6,10,14-trimethyl-1-prop-1-en-2-yloxypentadecane |
|---|---|
| PubChem CID | 123420659 |
| Molecular Formula | C21H42O |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.32 |
| IUPAC Name | 6,10,14-trimethyl-1-prop-1-en-2-yloxypentadecane |
| SMILES | C=C(C)OCCCCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C21H42O/c1-18(2)12-10-14-21(6)16-11-15-20(5)13-8-7-9-17-22-19(3)4/h18,20-21H,3,7-17H2,1-2,4-6H3 |
| InChIKey | OVTBGCDFAVZWMC-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|