C22H46O — CID 90478341
(3S,7R,11S)-1-ethoxy-3,7,11,15-tetramethylhexadecane (PubChem CID 90478341) has the molecular formula C22H46O and a molecular weight of 326.61 g/mol. Its IUPAC name is (3S,7R,11S)-1-ethoxy-3,7,11,15-tetramethylhexadecane.
| Compound Name | (3S,7R,11S)-1-ethoxy-3,7,11,15-tetramethylhexadecane |
|---|---|
| PubChem CID | 90478341 |
| Molecular Formula | C22H46O |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.35 |
| IUPAC Name | (3S,7R,11S)-1-ethoxy-3,7,11,15-tetramethylhexadecane |
| SMILES | CCOCC[C@@H](C)CCC[C@H](C)CCC[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C22H46O/c1-7-23-18-17-22(6)16-10-15-21(5)14-9-13-20(4)12-8-11-19(2)3/h19-22H,7-18H2,1-6H3/t20-,21+,22-/m0/s1 |
| InChIKey | MZGLUMCTSAXXFN-BDTNDASRSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|