About (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine
(4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine (PubChem CID 123421069) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine.
Analyze (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine?
The IUPAC name of (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine (CID 123421069) is (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine.
What is the SMILES notation for (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine?
The canonical SMILES for (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine is CC1=CC(C)=NCC1CN.
What is the InChIKey of (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine?
The InChIKey is CDQNYUFJZUUTNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-6-3-7(2)10-5-8(6)4-9/h3,8H,4-5,9H2,1-2H3.
What are the key properties of (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine?
(4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine has a molecular weight of 138.21 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethyl-2,3-dihydropyridin-3-yl)methanamine is sourced from PubChem (CID 123421069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).