About ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine
ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine (PubChem CID 144514602) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine.
Analyze ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine?
The IUPAC name of ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine (CID 144514602) is ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine.
What is the SMILES notation for ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine?
The canonical SMILES for ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine is CC.CC1C=CC(CN)=NC1.
What is the InChIKey of ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine?
The InChIKey is OAFNMMIVCXJNAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C2H6/c1-6-2-3-7(4-8)9-5-6;1-2/h2-3,6H,4-5,8H2,1H3;1-2H3.
What are the key properties of ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine?
ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine has a molecular weight of 154.26 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3-methyl-2,3-dihydropyridin-6-yl)methanamine is sourced from PubChem (CID 144514602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).