C12H25NO — CID 123421258
2-(2-aminopropan-2-yl)-3,4,4-trimethylhexanal (PubChem CID 123421258) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-(2-aminopropan-2-yl)-3,4,4-trimethylhexanal.
| Compound Name | 2-(2-aminopropan-2-yl)-3,4,4-trimethylhexanal |
|---|---|
| PubChem CID | 123421258 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2-(2-aminopropan-2-yl)-3,4,4-trimethylhexanal |
| SMILES | CCC(C)(C)C(C)C(C=O)C(C)(C)N |
| InChI | InChI=1S/C12H25NO/c1-7-11(3,4)9(2)10(8-14)12(5,6)13/h8-10H,7,13H2,1-6H3 |
| InChIKey | JQLWCRQOKJCATO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|