C16H32 — CID 123951483
5-ethenyl-3-ethyl-3,4,6,6-tetramethyloctane (PubChem CID 123951483) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is 5-ethenyl-3-ethyl-3,4,6,6-tetramethyloctane.
| Compound Name | 5-ethenyl-3-ethyl-3,4,6,6-tetramethyloctane |
|---|---|
| PubChem CID | 123951483 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | 5-ethenyl-3-ethyl-3,4,6,6-tetramethyloctane |
| SMILES | C=CC(C(C)C(C)(CC)CC)C(C)(C)CC |
| InChI | InChI=1S/C16H32/c1-9-14(15(6,7)10-2)13(5)16(8,11-3)12-4/h9,13-14H,1,10-12H2,2-8H3 |
| InChIKey | YEEXYCBZIZLJLQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|