C24H35N5O3 — CID 123421275
1-[2-[2-(2-amino-2-oxoethanimidoyl)-4-methylanilino]acetyl]-N-(3,3-dimethylcyclohexyl)pyrrolidine-2-carboxamide (PubChem CID 123421275) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-[2-[2-(2-amino-2-oxoethanimidoyl)-4-methylanilino]acetyl]-N-(3,3-dimethylcyclohexyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[2-(2-amino-2-oxoethanimidoyl)-4-methylanilino]acetyl]-N-(3,3-dimethylcyclohexyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123421275 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 1-[2-[2-(2-amino-2-oxoethanimidoyl)-4-methylanilino]acetyl]-N-(3,3-dimethylcyclohexyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\C(N)=O)c1cc(C)ccc1NCC(=O)N1CCCC1C(=O)NC1CCCC(C)(C)C1 |
| InChI | InChI=1S/C24H35N5O3/c1-15-8-9-18(17(12-15)21(25)22(26)31)27-14-20(30)29-11-5-7-19(29)23(32)28-16-6-4-10-24(2,3)13-16/h8-9,12,16,19,25,27H,4-7,10-11,13-14H2,1-3H3,(H2,26,31)(H,28,32)/b25-21- |
| InChIKey | WUQUIVHOPMVURX-DAFNUICNSA-N |
| XLogP | 2.34 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|