C20H25Cl2N5O3 — CID 123685079
1-[2-[2-(2-amino-2-oxoethanimidoyl)-5-methylanilino]acetyl]-N-[(2,2-dichlorocyclopropyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 123685079) has the molecular formula C20H25Cl2N5O3 and a molecular weight of 454.36 g/mol. Its IUPAC name is 1-[2-[2-(2-amino-2-oxoethanimidoyl)-5-methylanilino]acetyl]-N-[(2,2-dichlorocyclopropyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[2-(2-amino-2-oxoethanimidoyl)-5-methylanilino]acetyl]-N-[(2,2-dichlorocyclopropyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123685079 |
| Molecular Formula | C20H25Cl2N5O3 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-[2-[2-(2-amino-2-oxoethanimidoyl)-5-methylanilino]acetyl]-N-[(2,2-dichlorocyclopropyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\C(N)=O)c1ccc(C)cc1NCC(=O)N1CCCC1C(=O)NCC1CC1(Cl)Cl |
| InChI | InChI=1S/C20H25Cl2N5O3/c1-11-4-5-13(17(23)18(24)29)14(7-11)25-10-16(28)27-6-2-3-15(27)19(30)26-9-12-8-20(12,21)22/h4-5,7,12,15,23,25H,2-3,6,8-10H2,1H3,(H2,24,29)(H,26,30)/b23-17- |
| InChIKey | DVTLURDSFZEUGN-QJOMJCCJSA-N |
| XLogP | 1.56 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|