C15H25N — CID 123422222
N-(2-but-2-en-2-yl-1,2-diethyl-3-methylidenecyclobutyl)ethanimine (PubChem CID 123422222) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-(2-but-2-en-2-yl-1,2-diethyl-3-methylidenecyclobutyl)ethanimine.
| Compound Name | N-(2-but-2-en-2-yl-1,2-diethyl-3-methylidenecyclobutyl)ethanimine |
|---|---|
| PubChem CID | 123422222 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-(2-but-2-en-2-yl-1,2-diethyl-3-methylidenecyclobutyl)ethanimine |
| SMILES | C=C1CC(CC)(/N=C/C)C1(CC)C(C)=CC |
| InChI | InChI=1S/C15H25N/c1-7-12(5)15(9-3)13(6)11-14(15,8-2)16-10-4/h7,10H,6,8-9,11H2,1-5H3/b12-7?,16-10+ |
| InChIKey | WXKFCJXCKRKQJM-QAGSXOKCSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|