C13H19N — CID 91438172
N-[1-(cyclohexa-1,3-dien-1-ylmethyl)cyclobutyl]ethanimine (PubChem CID 91438172) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is N-[1-(cyclohexa-1,3-dien-1-ylmethyl)cyclobutyl]ethanimine.
| Compound Name | N-[1-(cyclohexa-1,3-dien-1-ylmethyl)cyclobutyl]ethanimine |
|---|---|
| PubChem CID | 91438172 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-[1-(cyclohexa-1,3-dien-1-ylmethyl)cyclobutyl]ethanimine |
| SMILES | C/C=N/C1(CC2=CC=CCC2)CCC1 |
| InChI | InChI=1S/C13H19N/c1-2-14-13(9-6-10-13)11-12-7-4-3-5-8-12/h2-4,7H,5-6,8-11H2,1H3/b14-2+ |
| InChIKey | MITOJBRRGBVSEG-JLZUIIAYSA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|