C12H19N — CID 123631403
5-pentan-2-yl-2-azabicyclo[4.2.0]octa-2,4-diene (PubChem CID 123631403) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 5-pentan-2-yl-2-azabicyclo[4.2.0]octa-2,4-diene.
| Compound Name | 5-pentan-2-yl-2-azabicyclo[4.2.0]octa-2,4-diene |
|---|---|
| PubChem CID | 123631403 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 5-pentan-2-yl-2-azabicyclo[4.2.0]octa-2,4-diene |
| SMILES | CCCC(C)C1=CC=NC2CCC12 |
| InChI | InChI=1S/C12H19N/c1-3-4-9(2)10-7-8-13-12-6-5-11(10)12/h7-9,11-12H,3-6H2,1-2H3 |
| InChIKey | DTCFDNLENHKBOB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |