C15H27N — CID 178128343
ethane;N-(2-ethenyl-6-propan-2-ylcyclohexen-1-yl)ethanimine (PubChem CID 178128343) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;N-(2-ethenyl-6-propan-2-ylcyclohexen-1-yl)ethanimine.
| Compound Name | ethane;N-(2-ethenyl-6-propan-2-ylcyclohexen-1-yl)ethanimine |
|---|---|
| PubChem CID | 178128343 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;N-(2-ethenyl-6-propan-2-ylcyclohexen-1-yl)ethanimine |
| SMILES | C=CC1=C(/N=C/C)C(C(C)C)CCC1.CC |
| InChI | InChI=1S/C13H21N.C2H6/c1-5-11-8-7-9-12(10(3)4)13(11)14-6-2;1-2/h5-6,10,12H,1,7-9H2,2-4H3;1-2H3/b14-6+; |
| InChIKey | WHPPGHNZODSNBW-JSSTZBRYSA-N |
| XLogP | 5.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|