C14H25N — CID 91349973
ethane;8-methyl-3,4,4a,5-tetrahydroquinoline (PubChem CID 91349973) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is ethane;8-methyl-3,4,4a,5-tetrahydroquinoline.
| Compound Name | ethane;8-methyl-3,4,4a,5-tetrahydroquinoline |
|---|---|
| PubChem CID | 91349973 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | ethane;8-methyl-3,4,4a,5-tetrahydroquinoline |
| SMILES | CC.CC.CC1=C2N=CCCC2CC=C1 |
| InChI | InChI=1S/C10H13N.2C2H6/c1-8-4-2-5-9-6-3-7-11-10(8)9;2*1-2/h2,4,7,9H,3,5-6H2,1H3;2*1-2H3 |
| InChIKey | JADJMEDWKQIGDQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |