C24H30N2O3 — CID 123422993
3-[3-(2-hydroxycyclopropyl)-3-oxoprop-1-enyl]-N-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]benzamide (PubChem CID 123422993) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-[3-(2-hydroxycyclopropyl)-3-oxoprop-1-enyl]-N-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]benzamide.
| Compound Name | 3-[3-(2-hydroxycyclopropyl)-3-oxoprop-1-enyl]-N-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 123422993 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 3-[3-(2-hydroxycyclopropyl)-3-oxoprop-1-enyl]-N-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]benzamide |
| SMILES | CC1=C(CC=NNC(=O)c2cccc(C=CC(=O)C3CC3O)c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H30N2O3/c1-16-6-5-12-24(2,3)20(16)11-13-25-26-23(29)18-8-4-7-17(14-18)9-10-21(27)19-15-22(19)28/h4,7-10,13-14,19,22,28H,5-6,11-12,15H2,1-3H3,(H,26,29) |
| InChIKey | DLXNTKIULBYOEO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|