About ethyl 2-(azocan-5-yl)acetate
ethyl 2-(azocan-5-yl)acetate (PubChem CID 123423074) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is ethyl 2-(azocan-5-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(azocan-5-yl)acetate |
| PubChem CID | 123423074 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | ethyl 2-(azocan-5-yl)acetate |
| SMILES | CCOC(=O)CC1CCCNCCC1 |
| InChI | InChI=1S/C11H21NO2/c1-2-14-11(13)9-10-5-3-7-12-8-4-6-10/h10,12H,2-9H2,1H3 |
| InChIKey | YIEZHEWTGZOWQX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(azocan-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(azocan-5-yl)acetate?
The IUPAC name of ethyl 2-(azocan-5-yl)acetate (CID 123423074) is ethyl 2-(azocan-5-yl)acetate.
What is the SMILES notation for ethyl 2-(azocan-5-yl)acetate?
The canonical SMILES for ethyl 2-(azocan-5-yl)acetate is CCOC(=O)CC1CCCNCCC1.
What is the InChIKey of ethyl 2-(azocan-5-yl)acetate?
The InChIKey is YIEZHEWTGZOWQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-2-14-11(13)9-10-5-3-7-12-8-4-6-10/h10,12H,2-9H2,1H3.
What are the key properties of ethyl 2-(azocan-5-yl)acetate?
ethyl 2-(azocan-5-yl)acetate has a molecular weight of 199.29 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(azocan-5-yl)acetate is sourced from PubChem (CID 123423074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).