About 2-propoxyethyl 2-piperidin-3-ylacetate
2-propoxyethyl 2-piperidin-3-ylacetate (PubChem CID 63686889) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-propoxyethyl 2-piperidin-3-ylacetate.
Molecular Properties
| Compound Name | 2-propoxyethyl 2-piperidin-3-ylacetate |
| PubChem CID | 63686889 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2-propoxyethyl 2-piperidin-3-ylacetate |
| SMILES | CCCOCCOC(=O)CC1CCCNC1 |
| InChI | InChI=1S/C12H23NO3/c1-2-6-15-7-8-16-12(14)9-11-4-3-5-13-10-11/h11,13H,2-10H2,1H3 |
| InChIKey | DMSXCOWBRWYNQD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propoxyethyl 2-piperidin-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxyethyl 2-piperidin-3-ylacetate?
The IUPAC name of 2-propoxyethyl 2-piperidin-3-ylacetate (CID 63686889) is 2-propoxyethyl 2-piperidin-3-ylacetate.
What is the SMILES notation for 2-propoxyethyl 2-piperidin-3-ylacetate?
The canonical SMILES for 2-propoxyethyl 2-piperidin-3-ylacetate is CCCOCCOC(=O)CC1CCCNC1.
What is the InChIKey of 2-propoxyethyl 2-piperidin-3-ylacetate?
The InChIKey is DMSXCOWBRWYNQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-2-6-15-7-8-16-12(14)9-11-4-3-5-13-10-11/h11,13H,2-10H2,1H3.
What are the key properties of 2-propoxyethyl 2-piperidin-3-ylacetate?
2-propoxyethyl 2-piperidin-3-ylacetate has a molecular weight of 229.32 g/mol, XLogP of 1.35, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxyethyl 2-piperidin-3-ylacetate is sourced from PubChem (CID 63686889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).