C15H15NO4 — CID 123424096
3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)benzoic acid (PubChem CID 123424096) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)benzoic acid.
| Compound Name | 3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 123424096 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(-n2c(O)c3c(c2O)CCCC3)c1 |
| InChI | InChI=1S/C15H15NO4/c17-13-11-6-1-2-7-12(11)14(18)16(13)10-5-3-4-9(8-10)15(19)20/h3-5,8,17-18H,1-2,6-7H2,(H,19,20) |
| InChIKey | QSJYBILXYDBFNY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |