C10H12O2 — CID 123425250
6-methyl-2,3,5,6-tetrahydrochromen-4-one (PubChem CID 123425250) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 6-methyl-2,3,5,6-tetrahydrochromen-4-one.
| Compound Name | 6-methyl-2,3,5,6-tetrahydrochromen-4-one |
|---|---|
| PubChem CID | 123425250 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 6-methyl-2,3,5,6-tetrahydrochromen-4-one |
| SMILES | CC1C=CC2=C(C1)C(=O)CCO2 |
| InChI | InChI=1S/C10H12O2/c1-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-3,7H,4-6H2,1H3 |
| InChIKey | REYLJDACVGCEKN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |