About 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one
2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one (PubChem CID 10727755) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one |
| PubChem CID | 10727755 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one |
| SMILES | C=C(OCCCC)C1=CC(C)(C)CCC1=O |
| InChI | InChI=1S/C14H22O2/c1-5-6-9-16-11(2)12-10-14(3,4)8-7-13(12)15/h10H,2,5-9H2,1,3-4H3 |
| InChIKey | AZGFPEAVXVJJEA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one?
The IUPAC name of 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one (CID 10727755) is 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one is C=C(OCCCC)C1=CC(C)(C)CCC1=O.
What is the InChIKey of 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one?
The InChIKey is AZGFPEAVXVJJEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-5-6-9-16-11(2)12-10-14(3,4)8-7-13(12)15/h10H,2,5-9H2,1,3-4H3.
What are the key properties of 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one?
2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one has a molecular weight of 222.33 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 10727755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).