C14H22O2 — CID 10727755
2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one (PubChem CID 10727755) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one.
| Compound Name | 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10727755 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-(1-butoxyethenyl)-4,4-dimethylcyclohex-2-en-1-one |
| SMILES | C=C(OCCCC)C1=CC(C)(C)CCC1=O |
| InChI | InChI=1S/C14H22O2/c1-5-6-9-16-11(2)12-10-14(3,4)8-7-13(12)15/h10H,2,5-9H2,1,3-4H3 |
| InChIKey | AZGFPEAVXVJJEA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|