C13H18O5 — CID 132933423
butyl 2-[(2S,6R)-6-hydroxy-6-methyl-3-oxopyran-2-yl]prop-2-enoate (PubChem CID 132933423) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is butyl 2-[(2S,6R)-6-hydroxy-6-methyl-3-oxopyran-2-yl]prop-2-enoate.
| Compound Name | butyl 2-[(2S,6R)-6-hydroxy-6-methyl-3-oxopyran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 132933423 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | butyl 2-[(2S,6R)-6-hydroxy-6-methyl-3-oxopyran-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCCCC)[C@@H]1O[C@@](C)(O)C=CC1=O |
| InChI | InChI=1S/C13H18O5/c1-4-5-8-17-12(15)9(2)11-10(14)6-7-13(3,16)18-11/h6-7,11,16H,2,4-5,8H2,1,3H3/t11-,13+/m0/s1 |
| InChIKey | KILRLPSRNURGCE-WCQYABFASA-N |
| XLogP | 1.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|