C17H28O2 — CID 175495478
butyl 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)prop-2-enoate (PubChem CID 175495478) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is butyl 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)prop-2-enoate.
| Compound Name | butyl 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 175495478 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | butyl 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OCCCC)C1CCCC2CCCCC21 |
| InChI | InChI=1S/C17H28O2/c1-3-4-12-19-17(18)13(2)15-11-7-9-14-8-5-6-10-16(14)15/h14-16H,2-12H2,1H3 |
| InChIKey | CSBVKWOVDPRVSU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|