About 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one
3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one (PubChem CID 123427419) has the molecular formula C22H19N5O
and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 123427419 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CC1NNc2cc(-c3ccc(Cn4cnc5ncccc5c4=O)cc3)ccc21 |
| InChI | InChI=1S/C22H19N5O/c1-14-18-9-8-17(11-20(18)26-25-14)16-6-4-15(5-7-16)12-27-13-24-21-19(22(27)28)3-2-10-23-21/h2-11,13-14,25-26H,12H2,1H3 |
| InChIKey | VCEVMTJYLRHNQU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one (CID 123427419) is 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one is CC1NNc2cc(-c3ccc(Cn4cnc5ncccc5c4=O)cc3)ccc21.
What is the InChIKey of 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is VCEVMTJYLRHNQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5O/c1-14-18-9-8-17(11-20(18)26-25-14)16-6-4-15(5-7-16)12-27-13-24-21-19(22(27)28)3-2-10-23-21/h2-11,13-14,25-26H,12H2,1H3.
What are the key properties of 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one?
3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 369.43 g/mol, XLogP of 3.50, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(3-methyl-2,3-dihydro-1H-indazol-6-yl)phenyl]methyl]pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 123427419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).