C22H25N7O4 — CID 123427816
4-[2-methoxy-3-(2-methoxyethylcarbamoyl)anilino]-N-methyl-6-(pyridin-2-ylamino)pyridazine-3-carboxamide (PubChem CID 123427816) has the molecular formula C22H25N7O4 and a molecular weight of 451.49 g/mol. Its IUPAC name is 4-[2-methoxy-3-(2-methoxyethylcarbamoyl)anilino]-N-methyl-6-(pyridin-2-ylamino)pyridazine-3-carboxamide.
| Compound Name | 4-[2-methoxy-3-(2-methoxyethylcarbamoyl)anilino]-N-methyl-6-(pyridin-2-ylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 123427816 |
| Molecular Formula | C22H25N7O4 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 4-[2-methoxy-3-(2-methoxyethylcarbamoyl)anilino]-N-methyl-6-(pyridin-2-ylamino)pyridazine-3-carboxamide |
| SMILES | CNC(=O)c1nnc(Nc2ccccn2)cc1Nc1cccc(C(=O)NCCOC)c1OC |
| InChI | InChI=1S/C22H25N7O4/c1-23-22(31)19-16(13-18(28-29-19)27-17-9-4-5-10-24-17)26-15-8-6-7-14(20(15)33-3)21(30)25-11-12-32-2/h4-10,13H,11-12H2,1-3H3,(H,23,31)(H,25,30)(H2,24,26,27,28) |
| InChIKey | ZRZDGACSFQRZHO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|