C24H27FN3+ — CID 123428741
2-[(1,1-dimethylpiperidin-1-ium-4-yl)methyl]-5-(6-fluoro-1H-indol-3-yl)-3H-indole (PubChem CID 123428741) has the molecular formula C24H27FN3+ and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[(1,1-dimethylpiperidin-1-ium-4-yl)methyl]-5-(6-fluoro-1H-indol-3-yl)-3H-indole.
| Compound Name | 2-[(1,1-dimethylpiperidin-1-ium-4-yl)methyl]-5-(6-fluoro-1H-indol-3-yl)-3H-indole |
|---|---|
| PubChem CID | 123428741 |
| Molecular Formula | C24H27FN3+ |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[(1,1-dimethylpiperidin-1-ium-4-yl)methyl]-5-(6-fluoro-1H-indol-3-yl)-3H-indole |
| SMILES | C[N+]1(C)CCC(CC2=Nc3ccc(-c4c[nH]c5cc(F)ccc45)cc3C2)CC1 |
| InChI | InChI=1S/C24H27FN3/c1-28(2)9-7-16(8-10-28)11-20-13-18-12-17(3-6-23(18)27-20)22-15-26-24-14-19(25)4-5-21(22)24/h3-6,12,14-16,26H,7-11,13H2,1-2H3/q+1 |
| InChIKey | YSCOCCNFOGSJKH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|