C15H16FN3 — CID 144924015
4-(6-fluoro-1H-indol-3-yl)benzene-1,2-diamine;methane (PubChem CID 144924015) has the molecular formula C15H16FN3 and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-(6-fluoro-1H-indol-3-yl)benzene-1,2-diamine;methane.
| Compound Name | 4-(6-fluoro-1H-indol-3-yl)benzene-1,2-diamine;methane |
|---|---|
| PubChem CID | 144924015 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-(6-fluoro-1H-indol-3-yl)benzene-1,2-diamine;methane |
| SMILES | C.Nc1ccc(-c2c[nH]c3cc(F)ccc23)cc1N |
| InChI | InChI=1S/C14H12FN3.CH4/c15-9-2-3-10-11(7-18-14(10)6-9)8-1-4-12(16)13(17)5-8;/h1-7,18H,16-17H2;1H4 |
| InChIKey | UERNLIXULBYESG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|