C18H19FN2O3S — CID 145257869
4-(6-fluoro-1H-indol-3-yl)benzenesulfonamide;oxolane (PubChem CID 145257869) has the molecular formula C18H19FN2O3S and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-(6-fluoro-1H-indol-3-yl)benzenesulfonamide;oxolane.
| Compound Name | 4-(6-fluoro-1H-indol-3-yl)benzenesulfonamide;oxolane |
|---|---|
| PubChem CID | 145257869 |
| Molecular Formula | C18H19FN2O3S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-(6-fluoro-1H-indol-3-yl)benzenesulfonamide;oxolane |
| SMILES | C1CCOC1.NS(=O)(=O)c1ccc(-c2c[nH]c3cc(F)ccc23)cc1 |
| InChI | InChI=1S/C14H11FN2O2S.C4H8O/c15-10-3-6-12-13(8-17-14(12)7-10)9-1-4-11(5-2-9)20(16,18)19;1-2-4-5-3-1/h1-8,17H,(H2,16,18,19);1-4H2 |
| InChIKey | ZBFDMTCNWLJTRH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |