C14H10ClFN2O2S — CID 126574533
3-chloro-4-(6-fluoro-1H-indol-3-yl)benzenesulfonamide (PubChem CID 126574533) has the molecular formula C14H10ClFN2O2S and a molecular weight of 324.76 g/mol. Its IUPAC name is 3-chloro-4-(6-fluoro-1H-indol-3-yl)benzenesulfonamide.
| Compound Name | 3-chloro-4-(6-fluoro-1H-indol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 126574533 |
| Molecular Formula | C14H10ClFN2O2S |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 3-chloro-4-(6-fluoro-1H-indol-3-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2c[nH]c3cc(F)ccc23)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN2O2S/c15-13-6-9(21(17,19)20)2-4-10(13)12-7-18-14-5-8(16)1-3-11(12)14/h1-7,18H,(H2,17,19,20) |
| InChIKey | RARWAEUZNOSPIV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |