C21H24FN4O4S+ — CID 126574737
4-[2-[[4-(6-fluoro-1H-indol-3-yl)phenyl]sulfonylamino]ethyl]morpholin-4-ium-4-carboxamide (PubChem CID 126574737) has the molecular formula C21H24FN4O4S+ and a molecular weight of 447.51 g/mol. Its IUPAC name is 4-[2-[[4-(6-fluoro-1H-indol-3-yl)phenyl]sulfonylamino]ethyl]morpholin-4-ium-4-carboxamide.
| Compound Name | 4-[2-[[4-(6-fluoro-1H-indol-3-yl)phenyl]sulfonylamino]ethyl]morpholin-4-ium-4-carboxamide |
|---|---|
| PubChem CID | 126574737 |
| Molecular Formula | C21H24FN4O4S+ |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-[2-[[4-(6-fluoro-1H-indol-3-yl)phenyl]sulfonylamino]ethyl]morpholin-4-ium-4-carboxamide |
| SMILES | NC(=O)[N+]1(CCNS(=O)(=O)c2ccc(-c3c[nH]c4cc(F)ccc34)cc2)CCOCC1 |
| InChI | InChI=1S/C21H23FN4O4S/c22-16-3-6-18-19(14-24-20(18)13-16)15-1-4-17(5-2-15)31(28,29)25-7-8-26(21(23)27)9-11-30-12-10-26/h1-6,13-14,24-25H,7-12H2,(H-,23,27)/p+1 |
| InChIKey | NBKNFNMTYZUVQL-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|