C19H20FN3O3S — CID 126574732
3-[[2-ethyl-4-(6-fluoro-1H-indol-3-yl)phenyl]sulfonylamino]propanamide (PubChem CID 126574732) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol. Its IUPAC name is 3-[[2-ethyl-4-(6-fluoro-1H-indol-3-yl)phenyl]sulfonylamino]propanamide.
| Compound Name | 3-[[2-ethyl-4-(6-fluoro-1H-indol-3-yl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 126574732 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-[[2-ethyl-4-(6-fluoro-1H-indol-3-yl)phenyl]sulfonylamino]propanamide |
| SMILES | CCc1cc(-c2c[nH]c3cc(F)ccc23)ccc1S(=O)(=O)NCCC(N)=O |
| InChI | InChI=1S/C19H20FN3O3S/c1-2-12-9-13(16-11-22-17-10-14(20)4-5-15(16)17)3-6-18(12)27(25,26)23-8-7-19(21)24/h3-6,9-11,22-23H,2,7-8H2,1H3,(H2,21,24) |
| InChIKey | DSWAQCGOKRNVJW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |