C17H16FNO2S — CID 126584312
2-[5-(6-fluoro-1H-indol-3-yl)-2-methylsulfinylphenyl]ethanol (PubChem CID 126584312) has the molecular formula C17H16FNO2S and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[5-(6-fluoro-1H-indol-3-yl)-2-methylsulfinylphenyl]ethanol.
| Compound Name | 2-[5-(6-fluoro-1H-indol-3-yl)-2-methylsulfinylphenyl]ethanol |
|---|---|
| PubChem CID | 126584312 |
| Molecular Formula | C17H16FNO2S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-[5-(6-fluoro-1H-indol-3-yl)-2-methylsulfinylphenyl]ethanol |
| SMILES | CS(=O)c1ccc(-c2c[nH]c3cc(F)ccc23)cc1CCO |
| InChI | InChI=1S/C17H16FNO2S/c1-22(21)17-5-2-11(8-12(17)6-7-20)15-10-19-16-9-13(18)3-4-14(15)16/h2-5,8-10,19-20H,6-7H2,1H3 |
| InChIKey | PMJIZRBGHGHURN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |