C18H17FN2O2S — CID 122538374
2-[5-(6-fluoro-1H-indol-3-yl)-3-(hydroxymethyl)-3H-1,2-benzothiazol-2-yl]ethanol (PubChem CID 122538374) has the molecular formula C18H17FN2O2S and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[5-(6-fluoro-1H-indol-3-yl)-3-(hydroxymethyl)-3H-1,2-benzothiazol-2-yl]ethanol.
| Compound Name | 2-[5-(6-fluoro-1H-indol-3-yl)-3-(hydroxymethyl)-3H-1,2-benzothiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 122538374 |
| Molecular Formula | C18H17FN2O2S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[5-(6-fluoro-1H-indol-3-yl)-3-(hydroxymethyl)-3H-1,2-benzothiazol-2-yl]ethanol |
| SMILES | OCCN1Sc2ccc(-c3c[nH]c4cc(F)ccc34)cc2C1CO |
| InChI | InChI=1S/C18H17FN2O2S/c19-12-2-3-13-15(9-20-16(13)8-12)11-1-4-18-14(7-11)17(10-23)21(24-18)5-6-22/h1-4,7-9,17,20,22-23H,5-6,10H2 |
| InChIKey | YQPIHVTUGHBTFL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|