C20H23N3S2 — CID 145155524
N-[2-[3-methyl-5-(6-methyl-1H-indol-3-yl)-3H-1,2-benzothiazol-2-yl]ethylsulfanyl]methanamine (PubChem CID 145155524) has the molecular formula C20H23N3S2 and a molecular weight of 369.56 g/mol. Its IUPAC name is N-[2-[3-methyl-5-(6-methyl-1H-indol-3-yl)-3H-1,2-benzothiazol-2-yl]ethylsulfanyl]methanamine.
| Compound Name | N-[2-[3-methyl-5-(6-methyl-1H-indol-3-yl)-3H-1,2-benzothiazol-2-yl]ethylsulfanyl]methanamine |
|---|---|
| PubChem CID | 145155524 |
| Molecular Formula | C20H23N3S2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[2-[3-methyl-5-(6-methyl-1H-indol-3-yl)-3H-1,2-benzothiazol-2-yl]ethylsulfanyl]methanamine |
| SMILES | CNSCCN1Sc2ccc(-c3c[nH]c4cc(C)ccc34)cc2C1C |
| InChI | InChI=1S/C20H23N3S2/c1-13-4-6-16-18(12-22-19(16)10-13)15-5-7-20-17(11-15)14(2)23(25-20)8-9-24-21-3/h4-7,10-12,14,21-22H,8-9H2,1-3H3 |
| InChIKey | BSGOPVULCORQFY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|