C19H18FN3S — CID 145155500
2-(azetidin-3-yl)-5-(6-fluoro-1H-indol-3-yl)-3-methyl-3H-1,2-benzothiazole (PubChem CID 145155500) has the molecular formula C19H18FN3S and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-5-(6-fluoro-1H-indol-3-yl)-3-methyl-3H-1,2-benzothiazole.
| Compound Name | 2-(azetidin-3-yl)-5-(6-fluoro-1H-indol-3-yl)-3-methyl-3H-1,2-benzothiazole |
|---|---|
| PubChem CID | 145155500 |
| Molecular Formula | C19H18FN3S |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-(azetidin-3-yl)-5-(6-fluoro-1H-indol-3-yl)-3-methyl-3H-1,2-benzothiazole |
| SMILES | CC1c2cc(-c3c[nH]c4cc(F)ccc34)ccc2SN1C1CNC1 |
| InChI | InChI=1S/C19H18FN3S/c1-11-16-6-12(2-5-19(16)24-23(11)14-8-21-9-14)17-10-22-18-7-13(20)3-4-15(17)18/h2-7,10-11,14,21-22H,8-9H2,1H3 |
| InChIKey | WLRHGKOZVRMNIQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|