C19H18FN3O4S — CID 135285814
(3-carbamoylcyclobutyl)-[4-(6-fluoro-1H-indol-3-yl)phenyl]sulfamic acid (PubChem CID 135285814) has the molecular formula C19H18FN3O4S and a molecular weight of 403.44 g/mol. Its IUPAC name is (3-carbamoylcyclobutyl)-[4-(6-fluoro-1H-indol-3-yl)phenyl]sulfamic acid.
| Compound Name | (3-carbamoylcyclobutyl)-[4-(6-fluoro-1H-indol-3-yl)phenyl]sulfamic acid |
|---|---|
| PubChem CID | 135285814 |
| Molecular Formula | C19H18FN3O4S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (3-carbamoylcyclobutyl)-[4-(6-fluoro-1H-indol-3-yl)phenyl]sulfamic acid |
| SMILES | NC(=O)C1CC(N(c2ccc(-c3c[nH]c4cc(F)ccc34)cc2)S(=O)(=O)O)C1 |
| InChI | InChI=1S/C19H18FN3O4S/c20-13-3-6-16-17(10-22-18(16)9-13)11-1-4-14(5-2-11)23(28(25,26)27)15-7-12(8-15)19(21)24/h1-6,9-10,12,15,22H,7-8H2,(H2,21,24)(H,25,26,27) |
| InChIKey | RXNDTFNFQWGVCY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|