C19H25F2N6O2+ — CID 123428846
[5-carbamoyl-3-fluoro-6-[(5-fluoro-3-pyridinyl)amino]-2-pyridinyl]-dimethyl-[3-(methylamino)oxan-4-yl]azanium (PubChem CID 123428846) has the molecular formula C19H25F2N6O2+ and a molecular weight of 407.45 g/mol. Its IUPAC name is [5-carbamoyl-3-fluoro-6-[(5-fluoro-3-pyridinyl)amino]-2-pyridinyl]-dimethyl-[3-(methylamino)oxan-4-yl]azanium.
| Compound Name | [5-carbamoyl-3-fluoro-6-[(5-fluoro-3-pyridinyl)amino]-2-pyridinyl]-dimethyl-[3-(methylamino)oxan-4-yl]azanium |
|---|---|
| PubChem CID | 123428846 |
| Molecular Formula | C19H25F2N6O2+ |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [5-carbamoyl-3-fluoro-6-[(5-fluoro-3-pyridinyl)amino]-2-pyridinyl]-dimethyl-[3-(methylamino)oxan-4-yl]azanium |
| SMILES | CNC1COCCC1[N+](C)(C)c1nc(Nc2cncc(F)c2)c(C(N)=O)cc1F |
| InChI | InChI=1S/C19H24F2N6O2/c1-23-15-10-29-5-4-16(15)27(2,3)19-14(21)7-13(17(22)28)18(26-19)25-12-6-11(20)8-24-9-12/h6-9,15-16,23H,4-5,10H2,1-3H3,(H2-,22,25,26,28)/p+1 |
| InChIKey | SGRPGVVMYXDGJO-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|