C22H31FN5O+ — CID 123145499
[5-carbamoyl-3-fluoro-6-(4-methylanilino)-2-pyridinyl]-dimethyl-[2-(methylamino)cyclohexyl]azanium (PubChem CID 123145499) has the molecular formula C22H31FN5O+ and a molecular weight of 400.52 g/mol. Its IUPAC name is [5-carbamoyl-3-fluoro-6-(4-methylanilino)-2-pyridinyl]-dimethyl-[2-(methylamino)cyclohexyl]azanium.
| Compound Name | [5-carbamoyl-3-fluoro-6-(4-methylanilino)-2-pyridinyl]-dimethyl-[2-(methylamino)cyclohexyl]azanium |
|---|---|
| PubChem CID | 123145499 |
| Molecular Formula | C22H31FN5O+ |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | [5-carbamoyl-3-fluoro-6-(4-methylanilino)-2-pyridinyl]-dimethyl-[2-(methylamino)cyclohexyl]azanium |
| SMILES | CNC1CCCCC1[N+](C)(C)c1nc(Nc2ccc(C)cc2)c(C(N)=O)cc1F |
| InChI | InChI=1S/C22H30FN5O/c1-14-9-11-15(12-10-14)26-21-16(20(24)29)13-17(23)22(27-21)28(3,4)19-8-6-5-7-18(19)25-2/h9-13,18-19,25H,5-8H2,1-4H3,(H2-,24,26,27,29)/p+1 |
| InChIKey | GJVOCGZBZINKND-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|