C33H38BF2N5O3 — CID 123429853
CID 123429853 (PubChem CID 123429853) has the molecular formula C33H38BF2N5O3 and a molecular weight of 601.51 g/mol.
| Compound Name | CID 123429853 |
|---|---|
| PubChem CID | 123429853 |
| Molecular Formula | C33H38BF2N5O3 |
| Molecular Weight | 601.51 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | — |
| SMILES | [B]c1cc(OCC(=O)N(C)C)cc(F)c1-c1nc(C(=O)Nc2cnccc2C2CC(N)C(C(C)C)C(CC=C)C2)ccc1F |
| InChI | InChI=1S/C33H38BF2N5O3/c1-6-7-19-12-20(13-26(37)30(19)18(2)3)22-10-11-38-16-28(22)40-33(43)27-9-8-24(35)32(39-27)31-23(34)14-21(15-25(31)36)44-17-29(42)41(4)5/h6,8-11,14-16,18-20,26,30H,1,7,12-13,17,37H2,2-5H3,(H,40,43) |
| InChIKey | BYDKVCCLVVYIRD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|