C8H13NS — CID 123431282
2,5-diethyl-6H-1,3-thiazine (PubChem CID 123431282) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 2,5-diethyl-6H-1,3-thiazine.
| Compound Name | 2,5-diethyl-6H-1,3-thiazine |
|---|---|
| PubChem CID | 123431282 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2,5-diethyl-6H-1,3-thiazine |
| SMILES | CCC1=CN=C(CC)SC1 |
| InChI | InChI=1S/C8H13NS/c1-3-7-5-9-8(4-2)10-6-7/h5H,3-4,6H2,1-2H3 |
| InChIKey | NOJSUSIJRIPMCI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |