C8H13NS — CID 142913826
(4Z)-2,5-dimethyl-7,8-dihydro-6H-1,3-thiazocine (PubChem CID 142913826) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is (4Z)-2,5-dimethyl-7,8-dihydro-6H-1,3-thiazocine.
| Compound Name | (4Z)-2,5-dimethyl-7,8-dihydro-6H-1,3-thiazocine |
|---|---|
| PubChem CID | 142913826 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (4Z)-2,5-dimethyl-7,8-dihydro-6H-1,3-thiazocine |
| SMILES | C/C1=C/N=C(/C)SCCC1 |
| InChI | InChI=1S/C8H13NS/c1-7-4-3-5-10-8(2)9-6-7/h6H,3-5H2,1-2H3/b7-6-,9-8- |
| InChIKey | VHIAYHHYBXXMDQ-JPDBVBESSA-N |
| XLogP | 2.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |