C30H43N3O3 — CID 123432047
3-[9-(7-bicyclo[4.2.2]decanyl)-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-2-[ethoxy(hydroxy)methyl]quinazolin-4-one (PubChem CID 123432047) has the molecular formula C30H43N3O3 and a molecular weight of 493.69 g/mol. Its IUPAC name is 3-[9-(7-bicyclo[4.2.2]decanyl)-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-2-[ethoxy(hydroxy)methyl]quinazolin-4-one.
| Compound Name | 3-[9-(7-bicyclo[4.2.2]decanyl)-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-2-[ethoxy(hydroxy)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 123432047 |
| Molecular Formula | C30H43N3O3 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | 3-[9-(7-bicyclo[4.2.2]decanyl)-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-2-[ethoxy(hydroxy)methyl]quinazolin-4-one |
| SMILES | CCOC(O)c1nc2ccccc2c(=O)n1C1CC2CCC(C)C(C1)N2C1CC2CCCCC1CC2 |
| InChI | InChI=1S/C30H43N3O3/c1-3-36-30(35)28-31-25-11-7-6-10-24(25)29(34)33(28)23-17-22-15-12-19(2)26(18-23)32(22)27-16-20-8-4-5-9-21(27)14-13-20/h6-7,10-11,19-23,26-27,30,35H,3-5,8-9,12-18H2,1-2H3 |
| InChIKey | DXLDSBAXAJTWLH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|