C32H46N4O2 — CID 126703758
2-[(2R)-2-[1-[(1R,3S,5R,6S)-9-[(1R,6S)-8-bicyclo[4.3.1]decanyl]-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl]benzimidazol-2-yl]pyrrolidin-1-yl]acetic acid (PubChem CID 126703758) has the molecular formula C32H46N4O2 and a molecular weight of 518.75 g/mol. Its IUPAC name is 2-[(2R)-2-[1-[(1R,3S,5R,6S)-9-[(1R,6S)-8-bicyclo[4.3.1]decanyl]-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl]benzimidazol-2-yl]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[(2R)-2-[1-[(1R,3S,5R,6S)-9-[(1R,6S)-8-bicyclo[4.3.1]decanyl]-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl]benzimidazol-2-yl]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 126703758 |
| Molecular Formula | C32H46N4O2 |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | 2-[(2R)-2-[1-[(1R,3S,5R,6S)-9-[(1R,6S)-8-bicyclo[4.3.1]decanyl]-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl]benzimidazol-2-yl]pyrrolidin-1-yl]acetic acid |
| SMILES | C[C@H]1CC[C@@H]2C[C@H](n3c([C@H]4CCCN4CC(=O)O)nc4ccccc43)C[C@H]1N2C1C[C@H]2CCCC[C@@H](C1)C2 |
| InChI | InChI=1S/C32H46N4O2/c1-21-12-13-24-18-26(19-30(21)35(24)25-16-22-7-2-3-8-23(15-22)17-25)36-28-10-5-4-9-27(28)33-32(36)29-11-6-14-34(29)20-31(37)38/h4-5,9-10,21-26,29-30H,2-3,6-8,11-20H2,1H3,(H,37,38)/t21-,22-,23+,24+,25?,26-,29+,30+/m0/s1 |
| InChIKey | BHPDQABNBXVXJV-GOVQWMKJSA-N |
| XLogP | 6.42 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |