C20H20 — CID 123433120
spiro[2,4-dihydro-1H-anthracene-3,5'-bicyclo[2.2.1]hept-1-ene] (PubChem CID 123433120) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is spiro[2,4-dihydro-1H-anthracene-3,5'-bicyclo[2.2.1]hept-1-ene].
| Compound Name | spiro[2,4-dihydro-1H-anthracene-3,5'-bicyclo[2.2.1]hept-1-ene] |
|---|---|
| PubChem CID | 123433120 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | spiro[2,4-dihydro-1H-anthracene-3,5'-bicyclo[2.2.1]hept-1-ene] |
| SMILES | C1=C2CC(C1)C1(CCc3cc4ccccc4cc3C1)C2 |
| InChI | InChI=1S/C20H20/c1-2-4-16-11-18-13-20(12-14-5-6-19(20)9-14)8-7-17(18)10-15(16)3-1/h1-5,10-11,19H,6-9,12-13H2 |
| InChIKey | HVATUUVZBCQZEQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|