C19H23N3O3 — CID 123435016
5-(3-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)-4-propan-2-ylpyrrolidine-2,3-dione (PubChem CID 123435016) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 5-(3-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)-4-propan-2-ylpyrrolidine-2,3-dione.
| Compound Name | 5-(3-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)-4-propan-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123435016 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 5-(3-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)-4-propan-2-ylpyrrolidine-2,3-dione |
| SMILES | CC(C)C1C(=O)C(=O)N(CCCn2ccnc2)C1c1cccc(O)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-13(2)16-17(14-5-3-6-15(23)11-14)22(19(25)18(16)24)9-4-8-21-10-7-20-12-21/h3,5-7,10-13,16-17,23H,4,8-9H2,1-2H3 |
| InChIKey | AMRFQAZRFXTPMB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|