C21H25N3O2 — CID 123573446
1-(3-imidazol-1-ylpropyl)-5-(2-phenylethenyl)-4-propan-2-ylpyrrolidine-2,3-dione (PubChem CID 123573446) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-5-(2-phenylethenyl)-4-propan-2-ylpyrrolidine-2,3-dione.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-5-(2-phenylethenyl)-4-propan-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123573446 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-5-(2-phenylethenyl)-4-propan-2-ylpyrrolidine-2,3-dione |
| SMILES | CC(C)C1C(=O)C(=O)N(CCCn2ccnc2)C1C=Cc1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-16(2)19-18(10-9-17-7-4-3-5-8-17)24(21(26)20(19)25)13-6-12-23-14-11-22-15-23/h3-5,7-11,14-16,18-19H,6,12-13H2,1-2H3 |
| InChIKey | OBLRGGGTCLXJOU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|