C25H22BrN3O3 — CID 126477674
(4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-[(E)-2-phenylethenyl]pyrrolidine-2,3-dione (PubChem CID 126477674) has the molecular formula C25H22BrN3O3 and a molecular weight of 492.37 g/mol. Its IUPAC name is (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-[(E)-2-phenylethenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-[(E)-2-phenylethenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 126477674 |
| Molecular Formula | C25H22BrN3O3 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-[(E)-2-phenylethenyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCn2ccnc2)C(/C=C/c2ccccc2)/C1=C(/O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H22BrN3O3/c26-20-10-8-19(9-11-20)23(30)22-21(12-7-18-5-2-1-3-6-18)29(25(32)24(22)31)15-4-14-28-16-13-27-17-28/h1-3,5-13,16-17,21,30H,4,14-15H2/b12-7+,23-22- |
| InChIKey | DEDSDKBXCKZCAA-MLQKRPKFSA-N |
| XLogP | 4.50 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|