C21H25N3O2 — CID 25099487
4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-[(E)-3-methylbut-1-enyl]-3-phenyl-2H-pyrrol-5-one (PubChem CID 25099487) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-[(E)-3-methylbut-1-enyl]-3-phenyl-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-[(E)-3-methylbut-1-enyl]-3-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 25099487 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-[(E)-3-methylbut-1-enyl]-3-phenyl-2H-pyrrol-5-one |
| SMILES | CC(C)/C=C/C1C(c2ccccc2)=C(O)C(=O)N1CCCn1ccnc1 |
| InChI | InChI=1S/C21H25N3O2/c1-16(2)9-10-18-19(17-7-4-3-5-8-17)20(25)21(26)24(18)13-6-12-23-14-11-22-15-23/h3-5,7-11,14-16,18,25H,6,12-13H2,1-2H3/b10-9+ |
| InChIKey | GFCNJPMZRYHGME-MDZDMXLPSA-N |
| XLogP | 3.67 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|