C26H23N5O2 — CID 123857939
1-(3-imidazol-1-ylpropyl)-4,5-bis(1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 123857939) has the molecular formula C26H23N5O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-4,5-bis(1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-4,5-bis(1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123857939 |
| Molecular Formula | C26H23N5O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-4,5-bis(1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCn2ccnc2)C(c2c[nH]c3ccccc23)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H23N5O2/c32-25-23(19-14-28-21-8-3-1-6-17(19)21)24(20-15-29-22-9-4-2-7-18(20)22)31(26(25)33)12-5-11-30-13-10-27-16-30/h1-4,6-10,13-16,23-24,28-29H,5,11-12H2 |
| InChIKey | GQFAKZUUKFSOFL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|